C24H36 — CID 21032637
(4aR,4bR,8aR)-2-(4-methylphenyl)-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene (PubChem CID 21032637) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is (4aR,4bR,8aR)-2-(4-methylphenyl)-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene.
| Compound Name | (4aR,4bR,8aR)-2-(4-methylphenyl)-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
|---|---|
| PubChem CID | 21032637 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | (4aR,4bR,8aR)-2-(4-methylphenyl)-7-propyl-1,2,3,4,4a,4b,5,6,7,8,8a,9,10,10a-tetradecahydrophenanthrene |
| SMILES | CCCC1CC[C@@H]2[C@H](CCC3CC(c4ccc(C)cc4)CC[C@H]32)C1 |
| InChI | InChI=1S/C24H36/c1-3-4-18-7-13-23-21(15-18)10-11-22-16-20(12-14-24(22)23)19-8-5-17(2)6-9-19/h5-6,8-9,18,20-24H,3-4,7,10-16H2,1-2H3/t18?,20?,21-,22?,23-,24-/m1/s1 |
| InChIKey | SUBLPMABAQGCQF-WNSFYAAGSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |