C18H24F4 — CID 162555914
2-fluoro-4-(4-pentan-2-ylcyclohexyl)-1-(trifluoromethyl)benzene (PubChem CID 162555914) has the molecular formula C18H24F4 and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-fluoro-4-(4-pentan-2-ylcyclohexyl)-1-(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-4-(4-pentan-2-ylcyclohexyl)-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 162555914 |
| Molecular Formula | C18H24F4 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-fluoro-4-(4-pentan-2-ylcyclohexyl)-1-(trifluoromethyl)benzene |
| SMILES | CCCC(C)C1CCC(c2ccc(C(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H24F4/c1-3-4-12(2)13-5-7-14(8-6-13)15-9-10-16(17(19)11-15)18(20,21)22/h9-14H,3-8H2,1-2H3 |
| InChIKey | ZQKRGIOWRQMYHU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |