C27H28F6O2 — CID 162555838
[3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-(4-pentan-2-ylcyclohexyl)benzoate (PubChem CID 162555838) has the molecular formula C27H28F6O2 and a molecular weight of 498.51 g/mol. Its IUPAC name is [3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-(4-pentan-2-ylcyclohexyl)benzoate.
| Compound Name | [3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-(4-pentan-2-ylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 162555838 |
| Molecular Formula | C27H28F6O2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [3,5-difluoro-4-[(E)-3,3,3-trifluoroprop-1-enyl]phenyl] 2-fluoro-4-(4-pentan-2-ylcyclohexyl)benzoate |
| SMILES | CCCC(C)C1CCC(c2ccc(C(=O)Oc3cc(F)c(/C=C/C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H28F6O2/c1-3-4-16(2)17-5-7-18(8-6-17)19-9-10-22(23(28)13-19)26(34)35-20-14-24(29)21(25(30)15-20)11-12-27(31,32)33/h9-18H,3-8H2,1-2H3/b12-11+ |
| InChIKey | XTZPUZOMBVUIDC-VAWYXSNFSA-N |
| XLogP | 8.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|