C25H39FSi — CID 154332836
ethyl-[4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]phenyl]silane (PubChem CID 154332836) has the molecular formula C25H39FSi and a molecular weight of 386.67 g/mol. Its IUPAC name is ethyl-[4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]phenyl]silane.
| Compound Name | ethyl-[4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]phenyl]silane |
|---|---|
| PubChem CID | 154332836 |
| Molecular Formula | C25H39FSi |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | ethyl-[4-[4-[4-[(E)-5-fluoropent-1-enyl]cyclohexyl]cyclohexyl]phenyl]silane |
| SMILES | CC[SiH2]c1ccc(C2CCC(C3CCC(/C=C/CCCF)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H39FSi/c1-2-27-25-17-15-24(16-18-25)23-13-11-22(12-14-23)21-9-7-20(8-10-21)6-4-3-5-19-26/h4,6,15-18,20-23H,2-3,5,7-14,19,27H2,1H3/b6-4+ |
| InChIKey | WMFLHFYNMAFDGU-GQCTYLIASA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|