C23H38Si — CID 123784930
ethyl-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]silane (PubChem CID 123784930) has the molecular formula C23H38Si and a molecular weight of 342.64 g/mol. Its IUPAC name is ethyl-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]silane.
| Compound Name | ethyl-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]silane |
|---|---|
| PubChem CID | 123784930 |
| Molecular Formula | C23H38Si |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | ethyl-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]silane |
| SMILES | CCCC1CCC(C2CCC(c3ccc([SiH2]CC)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H38Si/c1-3-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-16-23(17-15-22)24-4-2/h14-21H,3-13,24H2,1-2H3 |
| InChIKey | CUPYKPJBVYRZGK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|