C23H34O2 — CID 19026680
2-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]acetic acid (PubChem CID 19026680) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 19026680 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]acetic acid |
| SMILES | CCCC1CCC(C2CCC(c3ccc(CC(=O)O)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H34O2/c1-2-3-17-4-8-19(9-5-17)21-12-14-22(15-13-21)20-10-6-18(7-11-20)16-23(24)25/h6-7,10-11,17,19,21-22H,2-5,8-9,12-16H2,1H3,(H,24,25) |
| InChIKey | WNUGXDYVEDAYFR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |