C21H31F5S — CID 54147756
pentafluoro-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-λ6-sulfane (PubChem CID 54147756) has the molecular formula C21H31F5S and a molecular weight of 410.54 g/mol. Its IUPAC name is pentafluoro-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-λ6-sulfane.
| Compound Name | pentafluoro-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 54147756 |
| Molecular Formula | C21H31F5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | pentafluoro-[4-[4-(4-propylcyclohexyl)cyclohexyl]phenyl]-λ6-sulfane |
| SMILES | CCCC1CCC(C2CCC(c3ccc(S(F)(F)(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H31F5S/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(15-13-20)27(22,23,24,25)26/h12-19H,2-11H2,1H3 |
| InChIKey | OFOVIQRURSNOMB-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |