C26H25F2N — CID 54427913
2,6-difluoro-4-[4-[4-(4-propylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile (PubChem CID 54427913) has the molecular formula C26H25F2N and a molecular weight of 389.49 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[4-(4-propylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[4-[4-(4-propylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile |
|---|---|
| PubChem CID | 54427913 |
| Molecular Formula | C26H25F2N |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2,6-difluoro-4-[4-[4-(4-propylphenyl)cyclohexyl]but-3-en-1-ynyl]benzonitrile |
| SMILES | CCCc1ccc(C2CCC(C=CC#Cc3cc(F)c(C#N)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C26H25F2N/c1-2-5-19-8-12-22(13-9-19)23-14-10-20(11-15-23)6-3-4-7-21-16-25(27)24(18-29)26(28)17-21/h3,6,8-9,12-13,16-17,20,23H,2,5,10-11,14-15H2,1H3 |
| InChIKey | WFKPUBPWPZKOES-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|