C17H18N2 — CID 70523422
4-(4-prop-2-enylcyclohexyl)benzene-1,2-dicarbonitrile (PubChem CID 70523422) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-(4-prop-2-enylcyclohexyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-prop-2-enylcyclohexyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 70523422 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-(4-prop-2-enylcyclohexyl)benzene-1,2-dicarbonitrile |
| SMILES | C=CCC1CCC(c2ccc(C#N)c(C#N)c2)CC1 |
| InChI | InChI=1S/C17H18N2/c1-2-3-13-4-6-14(7-5-13)15-8-9-16(11-18)17(10-15)12-19/h2,8-10,13-14H,1,3-7H2 |
| InChIKey | HFCBQPVJMVYLKY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|