C20H26FN — CID 21292386
2-fluoro-4-(4-hept-6-enylcyclohexyl)benzonitrile (PubChem CID 21292386) has the molecular formula C20H26FN and a molecular weight of 299.43 g/mol. Its IUPAC name is 2-fluoro-4-(4-hept-6-enylcyclohexyl)benzonitrile.
| Compound Name | 2-fluoro-4-(4-hept-6-enylcyclohexyl)benzonitrile |
|---|---|
| PubChem CID | 21292386 |
| Molecular Formula | C20H26FN |
| Molecular Weight | 299.43 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-fluoro-4-(4-hept-6-enylcyclohexyl)benzonitrile |
| SMILES | C=CCCCCCC1CCC(c2ccc(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C20H26FN/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-13-19(15-22)20(21)14-18/h2,12-14,16-17H,1,3-11H2 |
| InChIKey | AIDKJWKVCBXAGT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.43 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|