C17H21F3 — CID 54212260
1,2,3-trifluoro-5-(4-pent-4-enylcyclohexyl)benzene (PubChem CID 54212260) has the molecular formula C17H21F3 and a molecular weight of 282.35 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-(4-pent-4-enylcyclohexyl)benzene.
| Compound Name | 1,2,3-trifluoro-5-(4-pent-4-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 54212260 |
| Molecular Formula | C17H21F3 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1,2,3-trifluoro-5-(4-pent-4-enylcyclohexyl)benzene |
| SMILES | C=CCCCC1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H21F3/c1-2-3-4-5-12-6-8-13(9-7-12)14-10-15(18)17(20)16(19)11-14/h2,10-13H,1,3-9H2 |
| InChIKey | PWSYOSDUOYRNOT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|