C24H31F5 — CID 54517135
1,3-difluoro-5-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]-2-(trifluoromethyl)benzene (PubChem CID 54517135) has the molecular formula C24H31F5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 54517135 |
| Molecular Formula | C24H31F5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1,3-difluoro-5-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]-2-(trifluoromethyl)benzene |
| SMILES | C=CCCCC1CCC(C2CCC(c3cc(F)c(C(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H31F5/c1-2-3-4-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-21(25)23(22(26)15-20)24(27,28)29/h2,14-19H,1,3-13H2 |
| InChIKey | YNEHYEVRDKLIFO-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|