C25H29F5 — CID 59246862
5-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 59246862) has the molecular formula C25H29F5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 5-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 5-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 59246862 |
| Molecular Formula | C25H29F5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 5-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | C=CCCC1CCC(C2CCC(c3cc(F)c(C#CC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H29F5/c1-2-3-4-17-5-7-18(8-6-17)19-9-11-20(12-10-19)21-15-23(26)22(24(27)16-21)13-14-25(28,29)30/h2,15-20H,1,3-12H2 |
| InChIKey | DAKLFMAAEAHQNU-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|