C28H24F4 — CID 139858293
6-[2-[4-(4-but-3-enylcyclohexyl)-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139858293) has the molecular formula C28H24F4 and a molecular weight of 436.49 g/mol. Its IUPAC name is 6-[2-[4-(4-but-3-enylcyclohexyl)-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[4-(4-but-3-enylcyclohexyl)-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139858293 |
| Molecular Formula | C28H24F4 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 6-[2-[4-(4-but-3-enylcyclohexyl)-2,6-difluorophenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | C=CCCC1CCC(c2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C28H24F4/c1-2-3-4-18-5-9-20(10-6-18)23-15-25(29)24(26(30)16-23)12-8-19-7-11-21-14-27(31)28(32)17-22(21)13-19/h2,7,11,13-18,20H,1,3-6,9-10H2 |
| InChIKey | VKIBOSHPTJOAEL-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|