C29H24F6 — CID 139854194
2,3-difluoro-6-[2-[2,3,5,6-tetrafluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethynyl]naphthalene (PubChem CID 139854194) has the molecular formula C29H24F6 and a molecular weight of 486.50 g/mol. Its IUPAC name is 2,3-difluoro-6-[2-[2,3,5,6-tetrafluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethynyl]naphthalene.
| Compound Name | 2,3-difluoro-6-[2-[2,3,5,6-tetrafluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139854194 |
| Molecular Formula | C29H24F6 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2,3-difluoro-6-[2-[2,3,5,6-tetrafluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCC1CCC(c2c(F)c(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C29H24F6/c1-2-3-4-5-17-6-10-19(11-7-17)25-28(34)26(32)22(27(33)29(25)35)13-9-18-8-12-20-15-23(30)24(31)16-21(20)14-18/h2-3,8,12,14-17,19H,4-7,10-11H2,1H3/b3-2+ |
| InChIKey | DMGKWAMFGRZIQY-NSCUHMNNSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|