C26H22F4O — CID 139859151
6-[2-[2,6-difluoro-4-[4-(methoxymethyl)cyclohexyl]phenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139859151) has the molecular formula C26H22F4O and a molecular weight of 426.45 g/mol. Its IUPAC name is 6-[2-[2,6-difluoro-4-[4-(methoxymethyl)cyclohexyl]phenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[2,6-difluoro-4-[4-(methoxymethyl)cyclohexyl]phenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139859151 |
| Molecular Formula | C26H22F4O |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 6-[2-[2,6-difluoro-4-[4-(methoxymethyl)cyclohexyl]phenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | COCC1CCC(c2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H22F4O/c1-31-15-17-3-6-18(7-4-17)21-12-23(27)22(24(28)13-21)9-5-16-2-8-19-11-25(29)26(30)14-20(19)10-16/h2,8,10-14,17-18H,3-4,6-7,15H2,1H3 |
| InChIKey | AYMWDLGKEKULPG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|