C25H33F5O — CID 54414712
5-[4-[2-(4-but-3-enylcyclohexyl)ethyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethoxy)benzene (PubChem CID 54414712) has the molecular formula C25H33F5O and a molecular weight of 444.53 g/mol. Its IUPAC name is 5-[4-[2-(4-but-3-enylcyclohexyl)ethyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 5-[4-[2-(4-but-3-enylcyclohexyl)ethyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54414712 |
| Molecular Formula | C25H33F5O |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 5-[4-[2-(4-but-3-enylcyclohexyl)ethyl]cyclohexyl]-1,3-difluoro-2-(trifluoromethoxy)benzene |
| SMILES | C=CCCC1CCC(CCC2CCC(c3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H33F5O/c1-2-3-4-17-5-7-18(8-6-17)9-10-19-11-13-20(14-12-19)21-15-22(26)24(23(27)16-21)31-25(28,29)30/h2,15-20H,1,3-14H2 |
| InChIKey | VWPBPXOCUUARSK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|