C18H19ClF4 — CID 59247553
1-chloro-3-fluoro-5-(4-propylcyclohexyl)-2-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 59247553) has the molecular formula C18H19ClF4 and a molecular weight of 346.80 g/mol. Its IUPAC name is 1-chloro-3-fluoro-5-(4-propylcyclohexyl)-2-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 1-chloro-3-fluoro-5-(4-propylcyclohexyl)-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 59247553 |
| Molecular Formula | C18H19ClF4 |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-chloro-3-fluoro-5-(4-propylcyclohexyl)-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | CCCC1CCC(c2cc(F)c(C#CC(F)(F)F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19ClF4/c1-2-3-12-4-6-13(7-5-12)14-10-16(19)15(17(20)11-14)8-9-18(21,22)23/h10-13H,2-7H2,1H3 |
| InChIKey | NVIUNMGIHNPJFE-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|