C26H25F5 — CID 59247028
1,3-difluoro-5-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 59247028) has the molecular formula C26H25F5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1,3-difluoro-5-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 1,3-difluoro-5-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 59247028 |
| Molecular Formula | C26H25F5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1,3-difluoro-5-[(E)-2-[4-(4-propylcyclohexyl)phenyl]ethenyl]-2-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | CCCC1CCC(c2ccc(/C=C/c3cc(F)c(C#CC(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C26H25F5/c1-2-3-18-6-10-21(11-7-18)22-12-8-19(9-13-22)4-5-20-16-24(27)23(25(28)17-20)14-15-26(29,30)31/h4-5,8-9,12-13,16-18,21H,2-3,6-7,10-11H2,1H3/b5-4+ |
| InChIKey | NTANJYHRYPITBL-SNAWJCMRSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|