C25H24F4 — CID 89134838
2-[(E)-2-(4-ethynyl-3,5-difluorophenyl)ethenyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene (PubChem CID 89134838) has the molecular formula C25H24F4 and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[(E)-2-(4-ethynyl-3,5-difluorophenyl)ethenyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene.
| Compound Name | 2-[(E)-2-(4-ethynyl-3,5-difluorophenyl)ethenyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 89134838 |
| Molecular Formula | C25H24F4 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[(E)-2-(4-ethynyl-3,5-difluorophenyl)ethenyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene |
| SMILES | C#Cc1c(F)cc(/C=C/c2c(F)cc(C3CCC(CCC)CC3)cc2F)cc1F |
| InChI | InChI=1S/C25H24F4/c1-3-5-16-6-9-18(10-7-16)19-14-24(28)21(25(29)15-19)11-8-17-12-22(26)20(4-2)23(27)13-17/h2,8,11-16,18H,3,5-7,9-10H2,1H3/b11-8+ |
| InChIKey | WBAYDNKAGCWJAQ-DHZHZOJOSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|