C17H18F4 — CID 59247636
4-(4-ethylcyclohexyl)-2-fluoro-1-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 59247636) has the molecular formula C17H18F4 and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-(4-ethylcyclohexyl)-2-fluoro-1-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 4-(4-ethylcyclohexyl)-2-fluoro-1-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 59247636 |
| Molecular Formula | C17H18F4 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-(4-ethylcyclohexyl)-2-fluoro-1-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | CCC1CCC(c2ccc(C#CC(F)(F)F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H18F4/c1-2-12-3-5-13(6-4-12)15-8-7-14(16(18)11-15)9-10-17(19,20)21/h7-8,11-13H,2-6H2,1H3 |
| InChIKey | FFNHXZYHJUVMHG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|