C24H32FNO2 — CID 19386551
2-fluoro-4-[4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile (PubChem CID 19386551) has the molecular formula C24H32FNO2 and a molecular weight of 385.52 g/mol. Its IUPAC name is 2-fluoro-4-[4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19386551 |
| Molecular Formula | C24H32FNO2 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-fluoro-4-[4-[5-[(E)-hept-5-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile |
| SMILES | C/C=C/CCCCC1COC(C2CCC(c3ccc(C#N)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C24H32FNO2/c1-2-3-4-5-6-7-18-16-27-24(28-17-18)20-10-8-19(9-11-20)21-12-13-22(15-26)23(25)14-21/h2-3,12-14,18-20,24H,4-11,16-17H2,1H3/b3-2+ |
| InChIKey | JLVAICRCQALQAU-NSCUHMNNSA-N |
| XLogP | 6.10 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|