C22H28FNO2 — CID 19386548
2-fluoro-4-[4-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile (PubChem CID 19386548) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is 2-fluoro-4-[4-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 19386548 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-fluoro-4-[4-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]cyclohexyl]benzonitrile |
| SMILES | CCC/C=C/C1COC(C2CCC(c3ccc(C#N)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C22H28FNO2/c1-2-3-4-5-16-14-25-22(26-15-16)18-8-6-17(7-9-18)19-10-11-20(13-24)21(23)12-19/h4-5,10-12,16-18,22H,2-3,6-9,14-15H2,1H3/b5-4+ |
| InChIKey | ZEZXGWCNEZLPFR-SNAWJCMRSA-N |
| XLogP | 5.32 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|