About (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate
(4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate (PubChem CID 57096609) has the molecular formula C21H24FNO4
and a molecular weight of 373.42 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate |
| PubChem CID | 57096609 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate |
| SMILES | CC=CC1COC(C2CCC(C(=O)Oc3ccc(C#N)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C21H24FNO4/c1-2-3-14-12-25-21(26-13-14)16-6-4-15(5-7-16)20(24)27-18-9-8-17(11-23)19(22)10-18/h2-3,8-10,14-16,21H,4-7,12-13H2,1H3 |
| InChIKey | VHBJNLWLTDOECB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate?
The IUPAC name of (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate (CID 57096609) is (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate.
What is the SMILES notation for (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate?
The canonical SMILES for (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate is CC=CC1COC(C2CCC(C(=O)Oc3ccc(C#N)c(F)c3)CC2)OC1.
What is the InChIKey of (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate?
The InChIKey is VHBJNLWLTDOECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FNO4/c1-2-3-14-12-25-21(26-13-14)16-6-4-15(5-7-16)20(24)27-18-9-8-17(11-23)19(22)10-18/h2-3,8-10,14-16,21H,4-7,12-13H2,1H3.
What are the key properties of (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate?
(4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate has a molecular weight of 373.42 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-3-fluorophenyl) 4-(5-prop-1-enyl-1,3-dioxan-2-yl)cyclohexane-1-carboxylate is sourced from PubChem (CID 57096609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).