C20H20ClFO2 — CID 139855683
(6-chloro-5-fluoronaphthalen-2-yl) 4-[(E)-prop-1-enyl]cyclohexane-1-carboxylate (PubChem CID 139855683) has the molecular formula C20H20ClFO2 and a molecular weight of 346.83 g/mol. Its IUPAC name is (6-chloro-5-fluoronaphthalen-2-yl) 4-[(E)-prop-1-enyl]cyclohexane-1-carboxylate.
| Compound Name | (6-chloro-5-fluoronaphthalen-2-yl) 4-[(E)-prop-1-enyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139855683 |
| Molecular Formula | C20H20ClFO2 |
| Molecular Weight | 346.83 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (6-chloro-5-fluoronaphthalen-2-yl) 4-[(E)-prop-1-enyl]cyclohexane-1-carboxylate |
| SMILES | C/C=C/C1CCC(C(=O)Oc2ccc3c(F)c(Cl)ccc3c2)CC1 |
| InChI | InChI=1S/C20H20ClFO2/c1-2-3-13-4-6-14(7-5-13)20(23)24-16-9-10-17-15(12-16)8-11-18(21)19(17)22/h2-3,8-14H,4-7H2,1H3/b3-2+ |
| InChIKey | CASWQONAROUTER-NSCUHMNNSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|