C29H43FO2 — CID 18997894
2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]-5-[(E)-pent-1-enyl]-1,3-dioxane (PubChem CID 18997894) has the molecular formula C29H43FO2 and a molecular weight of 442.66 g/mol. Its IUPAC name is 2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]-5-[(E)-pent-1-enyl]-1,3-dioxane.
| Compound Name | 2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]-5-[(E)-pent-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 18997894 |
| Molecular Formula | C29H43FO2 |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | 2-[4-[4-[2-(4-fluorophenyl)ethyl]cyclohexyl]cyclohexyl]-5-[(E)-pent-1-enyl]-1,3-dioxane |
| SMILES | CCC/C=C/C1COC(C2CCC(C3CCC(CCc4ccc(F)cc4)CC3)CC2)OC1 |
| InChI | InChI=1S/C29H43FO2/c1-2-3-4-5-24-20-31-29(32-21-24)27-16-14-26(15-17-27)25-12-8-22(9-13-25)6-7-23-10-18-28(30)19-11-23/h4-5,10-11,18-19,22,24-27,29H,2-3,6-9,12-17,20-21H2,1H3/b5-4+ |
| InChIKey | XNPZRPSEEVNCRB-SNAWJCMRSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|