C18H26O2 — CID 54332797
5-pent-1-enyl-2-(4-propylphenyl)-1,3-dioxane (PubChem CID 54332797) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 5-pent-1-enyl-2-(4-propylphenyl)-1,3-dioxane.
| Compound Name | 5-pent-1-enyl-2-(4-propylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 54332797 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5-pent-1-enyl-2-(4-propylphenyl)-1,3-dioxane |
| SMILES | CCCC=CC1COC(c2ccc(CCC)cc2)OC1 |
| InChI | InChI=1S/C18H26O2/c1-3-5-6-8-16-13-19-18(20-14-16)17-11-9-15(7-4-2)10-12-17/h6,8-12,16,18H,3-5,7,13-14H2,1-2H3 |
| InChIKey | SZNAZUWGVGMMPI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|