C21H29ClO2 — CID 19019259
2-(4-chlorophenyl)-5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxane (PubChem CID 19019259) has the molecular formula C21H29ClO2 and a molecular weight of 348.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 2-(4-chlorophenyl)-5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 19019259 |
| Molecular Formula | C21H29ClO2 |
| Molecular Weight | 348.91 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[4-[(E)-pent-1-enyl]cyclohexyl]-1,3-dioxane |
| SMILES | CCC/C=C/C1CCC(C2COC(c3ccc(Cl)cc3)OC2)CC1 |
| InChI | InChI=1S/C21H29ClO2/c1-2-3-4-5-16-6-8-17(9-7-16)19-14-23-21(24-15-19)18-10-12-20(22)13-11-18/h4-5,10-13,16-17,19,21H,2-3,6-9,14-15H2,1H3/b5-4+ |
| InChIKey | OZELHHZVVGKYPT-SNAWJCMRSA-N |
| XLogP | 6.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.91 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|