C21H28F2O4 — CID 22910649
2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane (PubChem CID 22910649) has the molecular formula C21H28F2O4 and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane.
| Compound Name | 2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 22910649 |
| Molecular Formula | C21H28F2O4 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-[2-[5-[(E)-pent-1-enyl]-1,3-dioxan-2-yl]ethyl]-1,3-dioxane |
| SMILES | CCC/C=C/C1COC(CCC2COC(c3ccc(F)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C21H28F2O4/c1-2-3-4-5-15-11-24-20(25-12-15)9-6-16-13-26-21(27-14-16)17-7-8-18(22)19(23)10-17/h4-5,7-8,10,15-16,20-21H,2-3,6,9,11-14H2,1H3/b5-4+ |
| InChIKey | MJMHGKYIFOAFPU-SNAWJCMRSA-N |
| XLogP | 4.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|