C23H31FO2 — CID 54130812
2-[4-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]phenyl]-5-pent-1-enyl-1,3-dioxane (PubChem CID 54130812) has the molecular formula C23H31FO2 and a molecular weight of 358.50 g/mol. Its IUPAC name is 2-[4-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]phenyl]-5-pent-1-enyl-1,3-dioxane.
| Compound Name | 2-[4-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]phenyl]-5-pent-1-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 54130812 |
| Molecular Formula | C23H31FO2 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2-[4-[2-(4-fluorocyclohex-3-en-1-yl)ethyl]phenyl]-5-pent-1-enyl-1,3-dioxane |
| SMILES | CCCC=CC1COC(c2ccc(CCC3CC=C(F)CC3)cc2)OC1 |
| InChI | InChI=1S/C23H31FO2/c1-2-3-4-5-20-16-25-23(26-17-20)21-12-8-18(9-13-21)6-7-19-10-14-22(24)15-11-19/h4-5,8-9,12-14,19-20,23H,2-3,6-7,10-11,15-17H2,1H3 |
| InChIKey | NUFOOLXYZGZAIL-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|