C35H55NO3 — CID 134486441
1-butoxy-4-[4-[5-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-1,3-dioxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 134486441) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is 1-butoxy-4-[4-[5-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-1,3-dioxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-butoxy-4-[4-[5-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-1,3-dioxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 134486441 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | 1-butoxy-4-[4-[5-[4-[(1E)-hexa-1,5-dienyl]cyclohexyl]-1,3-dioxan-2-yl]phenyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | C=CCC/C=C/C1CCC(C2COC(c3ccc(C4CC(C)(C)N(OCCCC)C(C)(C)C4)cc3)OC2)CC1 |
| InChI | InChI=1S/C35H55NO3/c1-7-9-11-12-13-27-14-16-29(17-15-27)32-25-37-33(38-26-32)30-20-18-28(19-21-30)31-23-34(3,4)36(35(5,6)24-31)39-22-10-8-2/h7,12-13,18-21,27,29,31-33H,1,8-11,14-17,22-26H2,2-6H3/b13-12+ |
| InChIKey | WBJLYAAQJNWAQP-OUKQBFOZSA-N |
| XLogP | 9.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|