C32H47NO — CID 134486503
4-[4-[4-(4-butoxycyclohexyl)phenyl]phenyl]-1,2,2,6,6-pentamethylpiperidine (PubChem CID 134486503) has the molecular formula C32H47NO and a molecular weight of 461.73 g/mol. Its IUPAC name is 4-[4-[4-(4-butoxycyclohexyl)phenyl]phenyl]-1,2,2,6,6-pentamethylpiperidine.
| Compound Name | 4-[4-[4-(4-butoxycyclohexyl)phenyl]phenyl]-1,2,2,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 134486503 |
| Molecular Formula | C32H47NO |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.37 |
| IUPAC Name | 4-[4-[4-(4-butoxycyclohexyl)phenyl]phenyl]-1,2,2,6,6-pentamethylpiperidine |
| SMILES | CCCCOC1CCC(c2ccc(-c3ccc(C4CC(C)(C)N(C)C(C)(C)C4)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H47NO/c1-7-8-21-34-30-19-17-27(18-20-30)26-11-9-24(10-12-26)25-13-15-28(16-14-25)29-22-31(2,3)33(6)32(4,5)23-29/h9-16,27,29-30H,7-8,17-23H2,1-6H3 |
| InChIKey | FCFVGVZUDHDUBG-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|