C18H37NO — CID 155074808
1,2,2,6,6-pentamethyl-4-octoxypiperidine (PubChem CID 155074808) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-octoxypiperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-octoxypiperidine |
|---|---|
| PubChem CID | 155074808 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-octoxypiperidine |
| SMILES | CCCCCCCCOC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C18H37NO/c1-7-8-9-10-11-12-13-20-16-14-17(2,3)19(6)18(4,5)15-16/h16H,7-15H2,1-6H3 |
| InChIKey | FWRVUEYQDRFADY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|