(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate

C13H26N2O4 — CID 139948387

IUPAC(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate
SMILESCCCCOC1CC(C)(C)N(O[N+](=O)[O-])C(C)(C)C1
InChIInChI=1S/C13H26N2O4/c1-6-7-8-18-11-9-12(2,3)14(19-15(16)17)13(4,5)10-11/h11H,6-10H2,1-5H3
InChIKeyYEABIVCCANKOJY-UHFFFAOYSA-N
MW274.36 g/mol
LogP2.95
Rot. Bonds6

About (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate

(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate (PubChem CID 139948387) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate.

Molecular Properties

Compound Name(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate
PubChem CID139948387
Molecular FormulaC13H26N2O4
Molecular Weight274.36 g/mol
Exact Mass274.19
IUPAC Name(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate
SMILESCCCCOC1CC(C)(C)N(O[N+](=O)[O-])C(C)(C)C1
InChIInChI=1S/C13H26N2O4/c1-6-7-8-18-11-9-12(2,3)14(19-15(16)17)13(4,5)10-11/h11H,6-10H2,1-5H3
InChIKeyYEABIVCCANKOJY-UHFFFAOYSA-N
XLogP2.95
TPSA64.84 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.36
LogP ≤ 52.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate?
The IUPAC name of (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate (CID 139948387) is (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate.
What is the SMILES notation for (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate?
The canonical SMILES for (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate is CCCCOC1CC(C)(C)N(O[N+](=O)[O-])C(C)(C)C1.
What is the InChIKey of (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate?
The InChIKey is YEABIVCCANKOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O4/c1-6-7-8-18-11-9-12(2,3)14(19-15(16)17)13(4,5)10-11/h11H,6-10H2,1-5H3.
What are the key properties of (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate?
(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate has a molecular weight of 274.36 g/mol, XLogP of 2.95, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate is sourced from PubChem (CID 139948387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).