C13H26N2O4 — CID 139948387
(4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate (PubChem CID 139948387) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate.
| Compound Name | (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate |
|---|---|
| PubChem CID | 139948387 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (4-butoxy-2,2,6,6-tetramethylpiperidin-1-yl) nitrate |
| SMILES | CCCCOC1CC(C)(C)N(O[N+](=O)[O-])C(C)(C)C1 |
| InChI | InChI=1S/C13H26N2O4/c1-6-7-8-18-11-9-12(2,3)14(19-15(16)17)13(4,5)10-11/h11H,6-10H2,1-5H3 |
| InChIKey | YEABIVCCANKOJY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|