C22H44N2O3 — CID 123943572
1-methoxy-2,2,6,6-tetramethyl-4-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethoxy]piperidine (PubChem CID 123943572) has the molecular formula C22H44N2O3 and a molecular weight of 384.61 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethyl-4-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethoxy]piperidine.
| Compound Name | 1-methoxy-2,2,6,6-tetramethyl-4-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethoxy]piperidine |
|---|---|
| PubChem CID | 123943572 |
| Molecular Formula | C22H44N2O3 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethyl-4-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethoxy]piperidine |
| SMILES | CON1C(C)(C)CC(OCCOC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C22H44N2O3/c1-19(2)13-17(14-20(3,4)23(19)9)26-11-12-27-18-15-21(5,6)24(25-10)22(7,8)16-18/h17-18H,11-16H2,1-10H3 |
| InChIKey | OFSJQAIDAYRLHS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|