C35H65N3O5 — CID 167105370
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate (PubChem CID 167105370) has the molecular formula C35H65N3O5 and a molecular weight of 607.92 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate |
|---|---|
| PubChem CID | 167105370 |
| Molecular Formula | C35H65N3O5 |
| Molecular Weight | 607.92 g/mol |
| Exact Mass | 607.49 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate |
| SMILES | CN1C(C)(C)CC(OCCC(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C35H65N3O5/c1-30(2)18-24(19-31(3,4)36(30)13)41-17-16-27(28(39)42-25-20-32(5,6)37(14)33(7,8)21-25)29(40)43-26-22-34(9,10)38(15)35(11,12)23-26/h24-27H,16-23H2,1-15H3 |
| InChIKey | GNTPOHUHQVMFBT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.92 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|