C35H65N3O6 — CID 129281730
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-hydroxy-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate (PubChem CID 129281730) has the molecular formula C35H65N3O6 and a molecular weight of 623.92 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-hydroxy-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-hydroxy-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate |
|---|---|
| PubChem CID | 129281730 |
| Molecular Formula | C35H65N3O6 |
| Molecular Weight | 623.92 g/mol |
| Exact Mass | 623.49 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[2-hydroxy-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxyethyl]propanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)C(CC(O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C35H65N3O6/c1-30(2)17-23(18-31(3,4)36(30)13)42-27(39)16-26(28(40)43-24-19-32(5,6)37(14)33(7,8)20-24)29(41)44-25-21-34(9,10)38(15)35(11,12)22-25/h23-27,39H,16-22H2,1-15H3 |
| InChIKey | JRDJCIZVZZSXJV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.92 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|