C28H56N2O4 — CID 129212649
1-methoxy-4-[8-(1-methoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxyoctoxy]-2,2,7,7-tetramethylazepane (PubChem CID 129212649) has the molecular formula C28H56N2O4 and a molecular weight of 484.77 g/mol. Its IUPAC name is 1-methoxy-4-[8-(1-methoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxyoctoxy]-2,2,7,7-tetramethylazepane.
| Compound Name | 1-methoxy-4-[8-(1-methoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxyoctoxy]-2,2,7,7-tetramethylazepane |
|---|---|
| PubChem CID | 129212649 |
| Molecular Formula | C28H56N2O4 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.42 |
| IUPAC Name | 1-methoxy-4-[8-(1-methoxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxyoctoxy]-2,2,7,7-tetramethylazepane |
| SMILES | CON1C(C)(C)CCC(OCCCCCCCCOC2CC(C)(C)N(OC)C2(C)C)CC1(C)C |
| InChI | InChI=1S/C28H56N2O4/c1-25(2)18-17-23(21-26(3,4)29(25)31-9)33-19-15-13-11-12-14-16-20-34-24-22-27(5,6)30(32-10)28(24,7)8/h23-24H,11-22H2,1-10H3 |
| InChIKey | JGDLSQOPOUSRQB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|