C14H27NO4 — CID 59891522
4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutanoic acid (PubChem CID 59891522) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is 4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutanoic acid.
| Compound Name | 4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutanoic acid |
|---|---|
| PubChem CID | 59891522 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 4-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxybutanoic acid |
| SMILES | CON1C(C)(C)CC(OCCCC(=O)O)CC1(C)C |
| InChI | InChI=1S/C14H27NO4/c1-13(2)9-11(19-8-6-7-12(16)17)10-14(3,4)15(13)18-5/h11H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | HSTJVSBSUWRWMF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|