C28H52N2O6 — CID 70489036
10-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxy-10-oxodecanoic acid (PubChem CID 70489036) has the molecular formula C28H52N2O6 and a molecular weight of 512.73 g/mol. Its IUPAC name is 10-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxy-10-oxodecanoic acid.
| Compound Name | 10-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxy-10-oxodecanoic acid |
|---|---|
| PubChem CID | 70489036 |
| Molecular Formula | C28H52N2O6 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.38 |
| IUPAC Name | 10-[4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-1-yl]oxy-10-oxodecanoic acid |
| SMILES | CC1(C)CC(ON2C(C)(C)CC(O)CC2(C)C)CC(C)(C)N1OC(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H52N2O6/c1-25(2)17-21(31)18-26(3,4)29(25)35-22-19-27(5,6)30(28(7,8)20-22)36-24(34)16-14-12-10-9-11-13-15-23(32)33/h21-22,31H,9-20H2,1-8H3,(H,32,33) |
| InChIKey | FFERZPLLLULFFB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|