C17H35NO6 — CID 174733730
ethanol;hexanedioic acid;2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 174733730) has the molecular formula C17H35NO6 and a molecular weight of 349.47 g/mol. Its IUPAC name is ethanol;hexanedioic acid;2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | ethanol;hexanedioic acid;2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 174733730 |
| Molecular Formula | C17H35NO6 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | ethanol;hexanedioic acid;2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1.CCO.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C9H19NO.C6H10O4.C2H6O/c1-8(2)5-7(11)6-9(3,4)10-8;7-5(8)3-1-2-4-6(9)10;1-2-3/h7,10-11H,5-6H2,1-4H3;1-4H2,(H,7,8)(H,9,10);3H,2H2,1H3 |
| InChIKey | MLUZGDFSDCTSQH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|