C19H44N2O2 — CID 174840743
N-butylbutan-1-amine;ethanol;2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 174840743) has the molecular formula C19H44N2O2 and a molecular weight of 332.57 g/mol. Its IUPAC name is N-butylbutan-1-amine;ethanol;2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | N-butylbutan-1-amine;ethanol;2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 174840743 |
| Molecular Formula | C19H44N2O2 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | N-butylbutan-1-amine;ethanol;2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1.CCCCNCCCC.CCO |
| InChI | InChI=1S/C9H19NO.C8H19N.C2H6O/c1-8(2)5-7(11)6-9(3,4)10-8;1-3-5-7-9-8-6-4-2;1-2-3/h7,10-11H,5-6H2,1-4H3;9H,3-8H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YDHCRDPOVVKKBW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|