C37H78N6 — CID 68740612
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;N-butyl-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 68740612) has the molecular formula C37H78N6 and a molecular weight of 607.07 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;N-butyl-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;N-butyl-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 68740612 |
| Molecular Formula | C37H78N6 |
| Molecular Weight | 607.07 g/mol |
| Exact Mass | 606.63 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine;N-butyl-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC1(C)CC(NCCCCCCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.CCCCNC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H50N4.C13H28N2/c1-21(2)15-19(16-22(3,4)27-21)25-13-11-9-10-12-14-26-20-17-23(5,6)28-24(7,8)18-20;1-6-7-8-14-11-9-12(2,3)15-13(4,5)10-11/h19-20,25-28H,9-18H2,1-8H3;11,14-15H,6-10H2,1-5H3 |
| InChIKey | WJOSYQWCNIATFB-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.07 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|