C24H49N3 — CID 173322725
N-hexyl-2,2,6,6-tetramethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine (PubChem CID 173322725) has the molecular formula C24H49N3 and a molecular weight of 379.68 g/mol. Its IUPAC name is N-hexyl-2,2,6,6-tetramethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine.
| Compound Name | N-hexyl-2,2,6,6-tetramethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 173322725 |
| Molecular Formula | C24H49N3 |
| Molecular Weight | 379.68 g/mol |
| Exact Mass | 379.39 |
| IUPAC Name | N-hexyl-2,2,6,6-tetramethyl-1-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine |
| SMILES | CCCCCCNC1CC(C)(C)N(C2CC(C)(C)NC(C)(C)C2)C(C)(C)C1 |
| InChI | InChI=1S/C24H49N3/c1-10-11-12-13-14-25-19-15-23(6,7)27(24(8,9)16-19)20-17-21(2,3)26-22(4,5)18-20/h19-20,25-26H,10-18H2,1-9H3 |
| InChIKey | SMCGWWQTWOMWNP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|