C34H70Br2N4 — CID 118091234
N,N'-bis(2,2,6,6-tetraethylpiperidin-4-yl)hexane-1,6-diamine;1,1-dibromoethane (PubChem CID 118091234) has the molecular formula C34H70Br2N4 and a molecular weight of 694.77 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetraethylpiperidin-4-yl)hexane-1,6-diamine;1,1-dibromoethane.
| Compound Name | N,N'-bis(2,2,6,6-tetraethylpiperidin-4-yl)hexane-1,6-diamine;1,1-dibromoethane |
|---|---|
| PubChem CID | 118091234 |
| Molecular Formula | C34H70Br2N4 |
| Molecular Weight | 694.77 g/mol |
| Exact Mass | 692.40 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetraethylpiperidin-4-yl)hexane-1,6-diamine;1,1-dibromoethane |
| SMILES | CC(Br)Br.CCC1(CC)CC(NCCCCCCNC2CC(CC)(CC)NC(CC)(CC)C2)CC(CC)(CC)N1 |
| InChI | InChI=1S/C32H66N4.C2H4Br2/c1-9-29(10-2)23-27(24-30(11-3,12-4)35-29)33-21-19-17-18-20-22-34-28-25-31(13-5,14-6)36-32(15-7,16-8)26-28;1-2(3)4/h27-28,33-36H,9-26H2,1-8H3;2H,1H3 |
| InChIKey | SBFBAUYQIMAJDB-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.77 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|