C43H85N9 — CID 159254799
6-[1,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N,2-N,4-N,4-N-tetrabutyl-1,3,5-triazine-2,4-diamine (PubChem CID 159254799) has the molecular formula C43H85N9 and a molecular weight of 728.22 g/mol. Its IUPAC name is 6-[1,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N,2-N,4-N,4-N-tetrabutyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N,2-N,4-N,4-N-tetrabutyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 159254799 |
| Molecular Formula | C43H85N9 |
| Molecular Weight | 728.22 g/mol |
| Exact Mass | 727.69 |
| IUPAC Name | 6-[1,6-bis[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N,2-N,4-N,4-N-tetrabutyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCN(CCCC)c1nc(C(CCCCCNC2CC(C)(C)NC(C)(C)C2)NC2CC(C)(C)NC(C)(C)C2)nc(N(CCCC)CCCC)n1 |
| InChI | InChI=1S/C43H85N9/c1-13-17-26-51(27-18-14-2)38-46-37(47-39(48-38)52(28-19-15-3)29-20-16-4)36(45-35-32-42(9,10)50-43(11,12)33-35)24-22-21-23-25-44-34-30-40(5,6)49-41(7,8)31-34/h34-36,44-45,49-50H,13-33H2,1-12H3 |
| InChIKey | KVTHQOKNZHKZPF-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.22 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|