C14H30N2 — CID 138568123
N-butyl-2,2,7,7-tetramethylazepan-4-amine (PubChem CID 138568123) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N-butyl-2,2,7,7-tetramethylazepan-4-amine.
| Compound Name | N-butyl-2,2,7,7-tetramethylazepan-4-amine |
|---|---|
| PubChem CID | 138568123 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-butyl-2,2,7,7-tetramethylazepan-4-amine |
| SMILES | CCCCNC1CCC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2/c1-6-7-10-15-12-8-9-13(2,3)16-14(4,5)11-12/h12,15-16H,6-11H2,1-5H3 |
| InChIKey | SULRCMCMAGCHRG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|