C12H25N2Si — CID 22982947
CID 22982947 (PubChem CID 22982947) has the molecular formula C12H25N2Si and a molecular weight of 225.43 g/mol.
| Compound Name | CID 22982947 |
|---|---|
| PubChem CID | 22982947 |
| Molecular Formula | C12H25N2Si |
| Molecular Weight | 225.43 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NCCC[Si])CC(C)(C)N1 |
| InChI | InChI=1S/C12H25N2Si/c1-11(2)8-10(13-6-5-7-15)9-12(3,4)14-11/h10,13-14H,5-9H2,1-4H3 |
| InChIKey | XOBYPROYGOZJPG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|