About CID 22982947
CID 22982947 (PubChem CID 22982947) has the molecular formula C12H25N2Si
and a molecular weight of 225.43 g/mol.
Molecular Properties
| Compound Name | CID 22982947 |
| PubChem CID | 22982947 |
| Molecular Formula | C12H25N2Si |
| Molecular Weight | 225.43 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NCCC[Si])CC(C)(C)N1 |
| InChI | InChI=1S/C12H25N2Si/c1-11(2)8-10(13-6-5-7-15)9-12(3,4)14-11/h10,13-14H,5-9H2,1-4H3 |
| InChIKey | XOBYPROYGOZJPG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22982947 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22982947?
The IUPAC name of CID 22982947 (CID 22982947) is not available.
What is the SMILES notation for CID 22982947?
The canonical SMILES for CID 22982947 is CC1(C)CC(NCCC[Si])CC(C)(C)N1.
What is the InChIKey of CID 22982947?
The InChIKey is XOBYPROYGOZJPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N2Si/c1-11(2)8-10(13-6-5-7-15)9-12(3,4)14-11/h10,13-14H,5-9H2,1-4H3.
What are the key properties of CID 22982947?
CID 22982947 has a molecular weight of 225.43 g/mol, XLogP of 1.86, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22982947 is sourced from PubChem (CID 22982947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).