C19H32N2 — CID 83457113
2,2,6,6-tetramethyl-N-[3-(4-methylphenyl)propyl]piperidin-4-amine (PubChem CID 83457113) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[3-(4-methylphenyl)propyl]piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-[3-(4-methylphenyl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 83457113 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[3-(4-methylphenyl)propyl]piperidin-4-amine |
| SMILES | Cc1ccc(CCCNC2CC(C)(C)NC(C)(C)C2)cc1 |
| InChI | InChI=1S/C19H32N2/c1-15-8-10-16(11-9-15)7-6-12-20-17-13-18(2,3)21-19(4,5)14-17/h8-11,17,20-21H,6-7,12-14H2,1-5H3 |
| InChIKey | XKDOKFUITHRKPM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|