C25H37N3 — CID 134179374
4-N-(4-butylphenyl)-1-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine (PubChem CID 134179374) has the molecular formula C25H37N3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 4-N-(4-butylphenyl)-1-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N-(4-butylphenyl)-1-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 134179374 |
| Molecular Formula | C25H37N3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | 4-N-(4-butylphenyl)-1-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzene-1,4-diamine |
| SMILES | CCCCc1ccc(Nc2ccc(NC3CC(C)(C)NC(C)(C)C3)cc2)cc1 |
| InChI | InChI=1S/C25H37N3/c1-6-7-8-19-9-11-20(12-10-19)26-21-13-15-22(16-14-21)27-23-17-24(2,3)28-25(4,5)18-23/h9-16,23,26-28H,6-8,17-18H2,1-5H3 |
| InChIKey | YKQAAUHLKMSXKM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|